C35H47NO10 — CID 91430427
[(2S,3R)-3-[(2S)-3-[3,4-bis(2,2-dimethylpropanoyloxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]oxybutan-2-yl] benzoate (PubChem CID 91430427) has the molecular formula C35H47NO10 and a molecular weight of 641.76 g/mol. Its IUPAC name is [(2S,3R)-3-[(2S)-3-[3,4-bis(2,2-dimethylpropanoyloxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]oxybutan-2-yl] benzoate.
| Compound Name | [(2S,3R)-3-[(2S)-3-[3,4-bis(2,2-dimethylpropanoyloxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]oxybutan-2-yl] benzoate |
|---|---|
| PubChem CID | 91430427 |
| Molecular Formula | C35H47NO10 |
| Molecular Weight | 641.76 g/mol |
| Exact Mass | 641.32 |
| IUPAC Name | [(2S,3R)-3-[(2S)-3-[3,4-bis(2,2-dimethylpropanoyloxy)phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoyl]oxybutan-2-yl] benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1)[C@@H](C)OC(=O)[C@H](Cc1ccc(OC(=O)C(C)(C)C)c(OC(=O)C(C)(C)C)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C35H47NO10/c1-21(42-28(37)24-15-13-12-14-16-24)22(2)43-29(38)25(36-32(41)46-35(9,10)11)19-23-17-18-26(44-30(39)33(3,4)5)27(20-23)45-31(40)34(6,7)8/h12-18,20-22,25H,19H2,1-11H3,(H,36,41)/t21-,22+,25-/m0/s1 |
| InChIKey | LGYSZWSGOZQNLK-FBLLAGFSSA-N |
| XLogP | 6.20 |
| TPSA | 143.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.76 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|