C38H54O8 — CID 131634142
[4-[(2S,3R)-4-[3,4-bis(2,2-dimethylpropanoyloxy)phenyl]-2,3-dimethylbutyl]-2-(2,2-dimethylpropanoyloxy)phenyl] 2,2-dimethylpropanoate (PubChem CID 131634142) has the molecular formula C38H54O8 and a molecular weight of 638.84 g/mol. Its IUPAC name is [4-[(2S,3R)-4-[3,4-bis(2,2-dimethylpropanoyloxy)phenyl]-2,3-dimethylbutyl]-2-(2,2-dimethylpropanoyloxy)phenyl] 2,2-dimethylpropanoate.
| Compound Name | [4-[(2S,3R)-4-[3,4-bis(2,2-dimethylpropanoyloxy)phenyl]-2,3-dimethylbutyl]-2-(2,2-dimethylpropanoyloxy)phenyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 131634142 |
| Molecular Formula | C38H54O8 |
| Molecular Weight | 638.84 g/mol |
| Exact Mass | 638.38 |
| IUPAC Name | [4-[(2S,3R)-4-[3,4-bis(2,2-dimethylpropanoyloxy)phenyl]-2,3-dimethylbutyl]-2-(2,2-dimethylpropanoyloxy)phenyl] 2,2-dimethylpropanoate |
| SMILES | C[C@H](Cc1ccc(OC(=O)C(C)(C)C)c(OC(=O)C(C)(C)C)c1)[C@@H](C)Cc1ccc(OC(=O)C(C)(C)C)c(OC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C38H54O8/c1-23(19-25-15-17-27(43-31(39)35(3,4)5)29(21-25)45-33(41)37(9,10)11)24(2)20-26-16-18-28(44-32(40)36(6,7)8)30(22-26)46-34(42)38(12,13)14/h15-18,21-24H,19-20H2,1-14H3/t23-,24+ |
| InChIKey | ABDZFVNAWRWRRN-PSWAGMNNSA-N |
| XLogP | 8.55 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.84 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|