C28H43NO8 — CID 66944122
2-[[(2S)-3-[3,4-bis(2,2-dimethylpropanoyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 2,3-dimethylbutanoate (PubChem CID 66944122) has the molecular formula C28H43NO8 and a molecular weight of 521.65 g/mol. Its IUPAC name is 2-[[(2S)-3-[3,4-bis(2,2-dimethylpropanoyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 2,3-dimethylbutanoate.
| Compound Name | 2-[[(2S)-3-[3,4-bis(2,2-dimethylpropanoyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 2,3-dimethylbutanoate |
|---|---|
| PubChem CID | 66944122 |
| Molecular Formula | C28H43NO8 |
| Molecular Weight | 521.65 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | 2-[[(2S)-3-[3,4-bis(2,2-dimethylpropanoyloxy)phenyl]-1-methoxy-1-oxopropan-2-yl]amino]ethyl 2,3-dimethylbutanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(OC(=O)C(C)(C)C)c(OC(=O)C(C)(C)C)c1)NCCOC(=O)C(C)C(C)C |
| InChI | InChI=1S/C28H43NO8/c1-17(2)18(3)23(30)35-14-13-29-20(24(31)34-10)15-19-11-12-21(36-25(32)27(4,5)6)22(16-19)37-26(33)28(7,8)9/h11-12,16-18,20,29H,13-15H2,1-10H3/t18?,20-/m0/s1 |
| InChIKey | VYZSMTNSDCOUDV-IJHRGXPZSA-N |
| XLogP | 4.10 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.65 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|