C21H14F15NO7 — CID 635369
[4-[3-oxo-2-(2,2,3,3,3-pentafluoropropanoylamino)-3-propan-2-yloxypropyl]-2-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 635369) has the molecular formula C21H14F15NO7 and a molecular weight of 677.31 g/mol. Its IUPAC name is [4-[3-oxo-2-(2,2,3,3,3-pentafluoropropanoylamino)-3-propan-2-yloxypropyl]-2-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [4-[3-oxo-2-(2,2,3,3,3-pentafluoropropanoylamino)-3-propan-2-yloxypropyl]-2-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 635369 |
| Molecular Formula | C21H14F15NO7 |
| Molecular Weight | 677.31 g/mol |
| Exact Mass | 677.05 |
| IUPAC Name | [4-[3-oxo-2-(2,2,3,3,3-pentafluoropropanoylamino)-3-propan-2-yloxypropyl]-2-(2,2,3,3,3-pentafluoropropanoyloxy)phenyl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | CC(C)OC(=O)C(Cc1ccc(OC(=O)C(F)(F)C(F)(F)F)c(OC(=O)C(F)(F)C(F)(F)F)c1)NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H14F15NO7/c1-7(2)42-12(38)9(37-13(39)16(22,23)19(28,29)30)5-8-3-4-10(43-14(40)17(24,25)20(31,32)33)11(6-8)44-15(41)18(26,27)21(34,35)36/h3-4,6-7,9H,5H2,1-2H3,(H,37,39) |
| InChIKey | GDESYZIQDFJABU-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.31 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|