C11H16F5NO3 — CID 612622
propan-2-yl 3-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate (PubChem CID 612622) has the molecular formula C11H16F5NO3 and a molecular weight of 305.24 g/mol. Its IUPAC name is propan-2-yl 3-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate.
| Compound Name | propan-2-yl 3-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate |
|---|---|
| PubChem CID | 612622 |
| Molecular Formula | C11H16F5NO3 |
| Molecular Weight | 305.24 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | propan-2-yl 3-methyl-2-(2,2,3,3,3-pentafluoropropanoylamino)butanoate |
| SMILES | CC(C)OC(=O)C(NC(=O)C(F)(F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C11H16F5NO3/c1-5(2)7(8(18)20-6(3)4)17-9(19)10(12,13)11(14,15)16/h5-7H,1-4H3,(H,17,19) |
| InChIKey | NAKMGZABTWXSBC-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.24 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|