C14H9F10NO4 — CID 88522903
[1-(4-hydroxyphenyl)-2-(2,2,3,3,3-pentafluoropropanoylamino)ethyl] 2,2,3,3,3-pentafluoropropanoate (PubChem CID 88522903) has the molecular formula C14H9F10NO4 and a molecular weight of 445.21 g/mol. Its IUPAC name is [1-(4-hydroxyphenyl)-2-(2,2,3,3,3-pentafluoropropanoylamino)ethyl] 2,2,3,3,3-pentafluoropropanoate.
| Compound Name | [1-(4-hydroxyphenyl)-2-(2,2,3,3,3-pentafluoropropanoylamino)ethyl] 2,2,3,3,3-pentafluoropropanoate |
|---|---|
| PubChem CID | 88522903 |
| Molecular Formula | C14H9F10NO4 |
| Molecular Weight | 445.21 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | [1-(4-hydroxyphenyl)-2-(2,2,3,3,3-pentafluoropropanoylamino)ethyl] 2,2,3,3,3-pentafluoropropanoate |
| SMILES | O=C(NCC(OC(=O)C(F)(F)C(F)(F)F)c1ccc(O)cc1)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H9F10NO4/c15-11(16,13(19,20)21)9(27)25-5-8(6-1-3-7(26)4-2-6)29-10(28)12(17,18)14(22,23)24/h1-4,8,26H,5H2,(H,25,27) |
| InChIKey | JWICPFTULJRQEE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.21 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|