C9H8F10N2O3 — CID 2851781
2,2,3,3,3-pentafluoro-N-[2-hydroxy-3-(2,2,3,3,3-pentafluoropropanoylamino)propyl]propanamide (PubChem CID 2851781) has the molecular formula C9H8F10N2O3 and a molecular weight of 382.15 g/mol. Its IUPAC name is 2,2,3,3,3-pentafluoro-N-[2-hydroxy-3-(2,2,3,3,3-pentafluoropropanoylamino)propyl]propanamide.
| Compound Name | 2,2,3,3,3-pentafluoro-N-[2-hydroxy-3-(2,2,3,3,3-pentafluoropropanoylamino)propyl]propanamide |
|---|---|
| PubChem CID | 2851781 |
| Molecular Formula | C9H8F10N2O3 |
| Molecular Weight | 382.15 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 2,2,3,3,3-pentafluoro-N-[2-hydroxy-3-(2,2,3,3,3-pentafluoropropanoylamino)propyl]propanamide |
| SMILES | O=C(NCC(O)CNC(=O)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H8F10N2O3/c10-6(11,8(14,15)16)4(23)20-1-3(22)2-21-5(24)7(12,13)9(17,18)19/h3,22H,1-2H2,(H,20,23)(H,21,24) |
| InChIKey | OOUOVHMFRJFTLE-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.15 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|