C7H8Cl6N2O3 — CID 10937789
2,2,2-trichloro-N-[2-hydroxy-3-[(2,2,2-trichloroacetyl)amino]propyl]acetamide (PubChem CID 10937789) has the molecular formula C7H8Cl6N2O3 and a molecular weight of 380.87 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[2-hydroxy-3-[(2,2,2-trichloroacetyl)amino]propyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[2-hydroxy-3-[(2,2,2-trichloroacetyl)amino]propyl]acetamide |
|---|---|
| PubChem CID | 10937789 |
| Molecular Formula | C7H8Cl6N2O3 |
| Molecular Weight | 380.87 g/mol |
| Exact Mass | 377.87 |
| IUPAC Name | 2,2,2-trichloro-N-[2-hydroxy-3-[(2,2,2-trichloroacetyl)amino]propyl]acetamide |
| SMILES | O=C(NCC(O)CNC(=O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H8Cl6N2O3/c8-6(9,10)4(17)14-1-3(16)2-15-5(18)7(11,12)13/h3,16H,1-2H2,(H,14,17)(H,15,18) |
| InChIKey | MXURHIPRRIXCDQ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.87 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|