C4H4Cl3NO3 — CID 134870395
(2S)-2-deuterio-2-[(2,2,2-trichloroacetyl)amino]acetic acid (PubChem CID 134870395) has the molecular formula C4H4Cl3NO3 and a molecular weight of 221.45 g/mol. Its IUPAC name is (2S)-2-deuterio-2-[(2,2,2-trichloroacetyl)amino]acetic acid.
| Compound Name | (2S)-2-deuterio-2-[(2,2,2-trichloroacetyl)amino]acetic acid |
|---|---|
| PubChem CID | 134870395 |
| Molecular Formula | C4H4Cl3NO3 |
| Molecular Weight | 221.45 g/mol |
| Exact Mass | 219.93 |
| IUPAC Name | (2S)-2-deuterio-2-[(2,2,2-trichloroacetyl)amino]acetic acid |
| SMILES | [2H][C@H](NC(=O)C(Cl)(Cl)Cl)C(=O)O |
| InChI | InChI=1S/C4H4Cl3NO3/c5-4(6,7)3(11)8-1-2(9)10/h1H2,(H,8,11)(H,9,10)/i1D/t1-/m0/s1 |
| InChIKey | KATCELVJLDODSG-YUYPMLDFSA-N |
| XLogP | 0.56 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.45 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|