C7H12Cl3N3O — CID 82163280
2,2,2-trichloro-N-(piperazin-1-ylmethyl)acetamide (PubChem CID 82163280) has the molecular formula C7H12Cl3N3O and a molecular weight of 260.55 g/mol. Its IUPAC name is 2,2,2-trichloro-N-(piperazin-1-ylmethyl)acetamide.
| Compound Name | 2,2,2-trichloro-N-(piperazin-1-ylmethyl)acetamide |
|---|---|
| PubChem CID | 82163280 |
| Molecular Formula | C7H12Cl3N3O |
| Molecular Weight | 260.55 g/mol |
| Exact Mass | 259.00 |
| IUPAC Name | 2,2,2-trichloro-N-(piperazin-1-ylmethyl)acetamide |
| SMILES | O=C(NCN1CCNCC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H12Cl3N3O/c8-7(9,10)6(14)12-5-13-3-1-11-2-4-13/h11H,1-5H2,(H,12,14) |
| InChIKey | DOUHVVPJHSPYGG-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.55 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|