C14H22Cl6N4O2 — CID 5084928
2,2,2-trichloro-N-[3-[4-[3-[(2,2,2-trichloroacetyl)amino]propyl]piperazin-1-yl]propyl]acetamide (PubChem CID 5084928) has the molecular formula C14H22Cl6N4O2 and a molecular weight of 491.07 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[3-[4-[3-[(2,2,2-trichloroacetyl)amino]propyl]piperazin-1-yl]propyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[3-[4-[3-[(2,2,2-trichloroacetyl)amino]propyl]piperazin-1-yl]propyl]acetamide |
|---|---|
| PubChem CID | 5084928 |
| Molecular Formula | C14H22Cl6N4O2 |
| Molecular Weight | 491.07 g/mol |
| Exact Mass | 487.99 |
| IUPAC Name | 2,2,2-trichloro-N-[3-[4-[3-[(2,2,2-trichloroacetyl)amino]propyl]piperazin-1-yl]propyl]acetamide |
| SMILES | O=C(NCCCN1CCN(CCCNC(=O)C(Cl)(Cl)Cl)CC1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C14H22Cl6N4O2/c15-13(16,17)11(25)21-3-1-5-23-7-9-24(10-8-23)6-2-4-22-12(26)14(18,19)20/h1-10H2,(H,21,25)(H,22,26) |
| InChIKey | SSPYTAJHLYSULQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.07 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|