C15H30N4O2 — CID 119391257
2,2-dimethyl-N-[3-oxo-3-(3-piperazin-1-ylpropylamino)propyl]propanamide (PubChem CID 119391257) has the molecular formula C15H30N4O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 2,2-dimethyl-N-[3-oxo-3-(3-piperazin-1-ylpropylamino)propyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[3-oxo-3-(3-piperazin-1-ylpropylamino)propyl]propanamide |
|---|---|
| PubChem CID | 119391257 |
| Molecular Formula | C15H30N4O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.24 |
| IUPAC Name | 2,2-dimethyl-N-[3-oxo-3-(3-piperazin-1-ylpropylamino)propyl]propanamide |
| SMILES | CC(C)(C)C(=O)NCCC(=O)NCCCN1CCNCC1 |
| InChI | InChI=1S/C15H30N4O2/c1-15(2,3)14(21)18-7-5-13(20)17-6-4-10-19-11-8-16-9-12-19/h16H,4-12H2,1-3H3,(H,17,20)(H,18,21) |
| InChIKey | FUWMUNMDOHYDII-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|