C15H31ClN4O2 — CID 119390933
3-methyl-N-[3-oxo-3-(3-piperazin-1-ylpropylamino)propyl]butanamide;hydrochloride (PubChem CID 119390933) has the molecular formula C15H31ClN4O2 and a molecular weight of 334.89 g/mol. Its IUPAC name is 3-methyl-N-[3-oxo-3-(3-piperazin-1-ylpropylamino)propyl]butanamide;hydrochloride.
| Compound Name | 3-methyl-N-[3-oxo-3-(3-piperazin-1-ylpropylamino)propyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119390933 |
| Molecular Formula | C15H31ClN4O2 |
| Molecular Weight | 334.89 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 3-methyl-N-[3-oxo-3-(3-piperazin-1-ylpropylamino)propyl]butanamide;hydrochloride |
| SMILES | CC(C)CC(=O)NCCC(=O)NCCCN1CCNCC1.Cl |
| InChI | InChI=1S/C15H30N4O2.ClH/c1-13(2)12-15(21)18-6-4-14(20)17-5-3-9-19-10-7-16-8-11-19;/h13,16H,3-12H2,1-2H3,(H,17,20)(H,18,21);1H |
| InChIKey | KHLIHUKYUKCADC-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.89 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|