C12H24BrN3O — CID 114328411
2-bromo-2-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]propanamide (PubChem CID 114328411) has the molecular formula C12H24BrN3O and a molecular weight of 306.25 g/mol. Its IUPAC name is 2-bromo-2-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]propanamide.
| Compound Name | 2-bromo-2-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]propanamide |
|---|---|
| PubChem CID | 114328411 |
| Molecular Formula | C12H24BrN3O |
| Molecular Weight | 306.25 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 2-bromo-2-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]propanamide |
| SMILES | CN1CCN(CCCNC(=O)C(C)(C)Br)CC1 |
| InChI | InChI=1S/C12H24BrN3O/c1-12(2,13)11(17)14-5-4-6-16-9-7-15(3)8-10-16/h4-10H2,1-3H3,(H,14,17) |
| InChIKey | USZBVRMDPDDVFW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|