C13H26BrN3O — CID 61251741
2-bromo-3-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]butanamide (PubChem CID 61251741) has the molecular formula C13H26BrN3O and a molecular weight of 320.27 g/mol. Its IUPAC name is 2-bromo-3-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]butanamide.
| Compound Name | 2-bromo-3-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]butanamide |
|---|---|
| PubChem CID | 61251741 |
| Molecular Formula | C13H26BrN3O |
| Molecular Weight | 320.27 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 2-bromo-3-methyl-N-[3-(4-methylpiperazin-1-yl)propyl]butanamide |
| SMILES | CC(C)C(Br)C(=O)NCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C13H26BrN3O/c1-11(2)12(14)13(18)15-5-4-6-17-9-7-16(3)8-10-17/h11-12H,4-10H2,1-3H3,(H,15,18) |
| InChIKey | PYLICIUCGHNISL-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|