C18H36N4O3 — CID 86921647
tert-butyl N-[3-methyl-1-[3-(4-methylpiperazin-1-yl)propylamino]-1-oxobutan-2-yl]carbamate (PubChem CID 86921647) has the molecular formula C18H36N4O3 and a molecular weight of 356.51 g/mol. Its IUPAC name is tert-butyl N-[3-methyl-1-[3-(4-methylpiperazin-1-yl)propylamino]-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[3-methyl-1-[3-(4-methylpiperazin-1-yl)propylamino]-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 86921647 |
| Molecular Formula | C18H36N4O3 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.28 |
| IUPAC Name | tert-butyl N-[3-methyl-1-[3-(4-methylpiperazin-1-yl)propylamino]-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)C(=O)NCCCN1CCN(C)CC1 |
| InChI | InChI=1S/C18H36N4O3/c1-14(2)15(20-17(24)25-18(3,4)5)16(23)19-8-7-9-22-12-10-21(6)11-13-22/h14-15H,7-13H2,1-6H3,(H,19,23)(H,20,24) |
| InChIKey | ZAXFGDLILDWHJG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|