C14H29N3O2 — CID 112604362
N-[3-(4-methylpiperazin-1-yl)propyl]-2-[(2-methylpropan-2-yl)oxy]acetamide (PubChem CID 112604362) has the molecular formula C14H29N3O2 and a molecular weight of 271.40 g/mol. Its IUPAC name is N-[3-(4-methylpiperazin-1-yl)propyl]-2-[(2-methylpropan-2-yl)oxy]acetamide.
| Compound Name | N-[3-(4-methylpiperazin-1-yl)propyl]-2-[(2-methylpropan-2-yl)oxy]acetamide |
|---|---|
| PubChem CID | 112604362 |
| Molecular Formula | C14H29N3O2 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | N-[3-(4-methylpiperazin-1-yl)propyl]-2-[(2-methylpropan-2-yl)oxy]acetamide |
| SMILES | CN1CCN(CCCNC(=O)COC(C)(C)C)CC1 |
| InChI | InChI=1S/C14H29N3O2/c1-14(2,3)19-12-13(18)15-6-5-7-17-10-8-16(4)9-11-17/h5-12H2,1-4H3,(H,15,18) |
| InChIKey | AEDJGSDXEVJHQJ-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|