C22H52N12O2 — CID 126654108
(2S)-2-amino-N-[3-[4-[3-[[(2S)-2-amino-5-(diaminomethylamino)pentanoyl]amino]propyl]piperazin-1-yl]propyl]-5-(diaminomethylamino)pentanamide (PubChem CID 126654108) has the molecular formula C22H52N12O2 and a molecular weight of 516.74 g/mol. Its IUPAC name is (2S)-2-amino-N-[3-[4-[3-[[(2S)-2-amino-5-(diaminomethylamino)pentanoyl]amino]propyl]piperazin-1-yl]propyl]-5-(diaminomethylamino)pentanamide.
| Compound Name | (2S)-2-amino-N-[3-[4-[3-[[(2S)-2-amino-5-(diaminomethylamino)pentanoyl]amino]propyl]piperazin-1-yl]propyl]-5-(diaminomethylamino)pentanamide |
|---|---|
| PubChem CID | 126654108 |
| Molecular Formula | C22H52N12O2 |
| Molecular Weight | 516.74 g/mol |
| Exact Mass | 516.43 |
| IUPAC Name | (2S)-2-amino-N-[3-[4-[3-[[(2S)-2-amino-5-(diaminomethylamino)pentanoyl]amino]propyl]piperazin-1-yl]propyl]-5-(diaminomethylamino)pentanamide |
| SMILES | NC(N)NCCC[C@H](N)C(=O)NCCCN1CCN(CCCNC(=O)[C@@H](N)CCCNC(N)N)CC1 |
| InChI | InChI=1S/C22H52N12O2/c23-17(5-1-7-31-21(25)26)19(35)29-9-3-11-33-13-15-34(16-14-33)12-4-10-30-20(36)18(24)6-2-8-32-22(27)28/h17-18,21-22,31-32H,1-16,23-28H2,(H,29,35)(H,30,36)/t17-,18-/m0/s1 |
| InChIKey | PEDUHPQORGKCBE-ROUUACIJSA-N |
| XLogP | -4.59 |
| TPSA | 244.86 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.74 |
| LogP ≤ 5 | -4.59 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|