C20H33N3O2 — CID 110437822
2-(4-methoxyphenyl)-2-methyl-N-[4-(4-methylpiperazin-1-yl)butyl]propanamide (PubChem CID 110437822) has the molecular formula C20H33N3O2 and a molecular weight of 347.50 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-2-methyl-N-[4-(4-methylpiperazin-1-yl)butyl]propanamide.
| Compound Name | 2-(4-methoxyphenyl)-2-methyl-N-[4-(4-methylpiperazin-1-yl)butyl]propanamide |
|---|---|
| PubChem CID | 110437822 |
| Molecular Formula | C20H33N3O2 |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.26 |
| IUPAC Name | 2-(4-methoxyphenyl)-2-methyl-N-[4-(4-methylpiperazin-1-yl)butyl]propanamide |
| SMILES | COc1ccc(C(C)(C)C(=O)NCCCCN2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C20H33N3O2/c1-20(2,17-7-9-18(25-4)10-8-17)19(24)21-11-5-6-12-23-15-13-22(3)14-16-23/h7-10H,5-6,11-16H2,1-4H3,(H,21,24) |
| InChIKey | TYFLVGVTSRWUBL-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|