C6H5Cl6NO3 — CID 2726052
2-[(2,2,2-trichloroacetyl)amino]ethyl 2,2,2-trichloroacetate (PubChem CID 2726052) has the molecular formula C6H5Cl6NO3 and a molecular weight of 351.83 g/mol. Its IUPAC name is 2-[(2,2,2-trichloroacetyl)amino]ethyl 2,2,2-trichloroacetate.
| Compound Name | 2-[(2,2,2-trichloroacetyl)amino]ethyl 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 2726052 |
| Molecular Formula | C6H5Cl6NO3 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 348.84 |
| IUPAC Name | 2-[(2,2,2-trichloroacetyl)amino]ethyl 2,2,2-trichloroacetate |
| SMILES | O=C(NCCOC(=O)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H5Cl6NO3/c7-5(8,9)3(14)13-1-2-16-4(15)6(10,11)12/h1-2H2,(H,13,14) |
| InChIKey | ZZGYPDWKWDPEDB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|