C5H10Cl3N2O3S+ — CID 135703173
carbamothioylazanium;2-hydroxyethyl 2,2,2-trichloroacetate (PubChem CID 135703173) has the molecular formula C5H10Cl3N2O3S+ and a molecular weight of 284.57 g/mol. Its IUPAC name is carbamothioylazanium;2-hydroxyethyl 2,2,2-trichloroacetate.
| Compound Name | carbamothioylazanium;2-hydroxyethyl 2,2,2-trichloroacetate |
|---|---|
| PubChem CID | 135703173 |
| Molecular Formula | C5H10Cl3N2O3S+ |
| Molecular Weight | 284.57 g/mol |
| Exact Mass | 282.95 |
| IUPAC Name | carbamothioylazanium;2-hydroxyethyl 2,2,2-trichloroacetate |
| SMILES | NC([NH3+])=S.O=C(OCCO)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C4H5Cl3O3.CH4N2S/c5-4(6,7)3(9)10-2-1-8;2-1(3)4/h8H,1-2H2;(H4,2,3,4)/p+1 |
| InChIKey | VJMCHDHDVQMANI-UHFFFAOYSA-O |
| XLogP | -0.64 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.57 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|