C14H28O3 — CID 87664752
2-hydroxyethyl 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 87664752) has the molecular formula C14H28O3 and a molecular weight of 244.37 g/mol. Its IUPAC name is 2-hydroxyethyl 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | 2-hydroxyethyl 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 87664752 |
| Molecular Formula | C14H28O3 |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 2-hydroxyethyl 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CC(C)(C)CC(C)(C(=O)OCCO)C(C)(C)C |
| InChI | InChI=1S/C14H28O3/c1-12(2,3)10-14(7,13(4,5)6)11(16)17-9-8-15/h15H,8-10H2,1-7H3 |
| InChIKey | LDRXIAWAILHPFN-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |