C19H38NO4+ — CID 122576947
2-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyethyl-(2-carboxyethyl)-dimethylazanium (PubChem CID 122576947) has the molecular formula C19H38NO4+ and a molecular weight of 344.52 g/mol. Its IUPAC name is 2-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyethyl-(2-carboxyethyl)-dimethylazanium.
| Compound Name | 2-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyethyl-(2-carboxyethyl)-dimethylazanium |
|---|---|
| PubChem CID | 122576947 |
| Molecular Formula | C19H38NO4+ |
| Molecular Weight | 344.52 g/mol |
| Exact Mass | 344.28 |
| IUPAC Name | 2-(2-tert-butyl-2,4,4-trimethylpentanoyl)oxyethyl-(2-carboxyethyl)-dimethylazanium |
| SMILES | CC(C)(C)CC(C)(C(=O)OCC[N+](C)(C)CCC(=O)O)C(C)(C)C |
| InChI | InChI=1S/C19H37NO4/c1-17(2,3)14-19(7,18(4,5)6)16(23)24-13-12-20(8,9)11-10-15(21)22/h10-14H2,1-9H3/p+1 |
| InChIKey | PZJLCZHAYQSLOP-UHFFFAOYSA-O |
| XLogP | 3.57 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.52 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|