C16H33NO4S — CID 118348646
3-(methanesulfonamido)propyl 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 118348646) has the molecular formula C16H33NO4S and a molecular weight of 335.51 g/mol. Its IUPAC name is 3-(methanesulfonamido)propyl 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | 3-(methanesulfonamido)propyl 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 118348646 |
| Molecular Formula | C16H33NO4S |
| Molecular Weight | 335.51 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 3-(methanesulfonamido)propyl 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CC(C)(C)CC(C)(C(=O)OCCCNS(C)(=O)=O)C(C)(C)C |
| InChI | InChI=1S/C16H33NO4S/c1-14(2,3)12-16(7,15(4,5)6)13(18)21-11-9-10-17-22(8,19)20/h17H,9-12H2,1-8H3 |
| InChIKey | SEZRXZSWFHRMET-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|