About 3-(methanesulfonamido)propyl 2-tert-butyl-2,4,4-trimethylpentanoate
3-(methanesulfonamido)propyl 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 118348646) has the molecular formula C16H33NO4S
and a molecular weight of 335.51 g/mol. Its IUPAC name is 3-(methanesulfonamido)propyl 2-tert-butyl-2,4,4-trimethylpentanoate.
Molecular Properties
| Compound Name | 3-(methanesulfonamido)propyl 2-tert-butyl-2,4,4-trimethylpentanoate |
| PubChem CID | 118348646 |
| Molecular Formula | C16H33NO4S |
| Molecular Weight | 335.51 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | 3-(methanesulfonamido)propyl 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CC(C)(C)CC(C)(C(=O)OCCCNS(C)(=O)=O)C(C)(C)C |
| InChI | InChI=1S/C16H33NO4S/c1-14(2,3)12-16(7,15(4,5)6)13(18)21-11-9-10-17-22(8,19)20/h17H,9-12H2,1-8H3 |
| InChIKey | SEZRXZSWFHRMET-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.51 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(methanesulfonamido)propyl 2-tert-butyl-2,4,4-trimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methanesulfonamido)propyl 2-tert-butyl-2,4,4-trimethylpentanoate?
The IUPAC name of 3-(methanesulfonamido)propyl 2-tert-butyl-2,4,4-trimethylpentanoate (CID 118348646) is 3-(methanesulfonamido)propyl 2-tert-butyl-2,4,4-trimethylpentanoate.
What is the SMILES notation for 3-(methanesulfonamido)propyl 2-tert-butyl-2,4,4-trimethylpentanoate?
The canonical SMILES for 3-(methanesulfonamido)propyl 2-tert-butyl-2,4,4-trimethylpentanoate is CC(C)(C)CC(C)(C(=O)OCCCNS(C)(=O)=O)C(C)(C)C.
What is the InChIKey of 3-(methanesulfonamido)propyl 2-tert-butyl-2,4,4-trimethylpentanoate?
The InChIKey is SEZRXZSWFHRMET-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H33NO4S/c1-14(2,3)12-16(7,15(4,5)6)13(18)21-11-9-10-17-22(8,19)20/h17H,9-12H2,1-8H3.
What are the key properties of 3-(methanesulfonamido)propyl 2-tert-butyl-2,4,4-trimethylpentanoate?
3-(methanesulfonamido)propyl 2-tert-butyl-2,4,4-trimethylpentanoate has a molecular weight of 335.51 g/mol, XLogP of 2.96, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methanesulfonamido)propyl 2-tert-butyl-2,4,4-trimethylpentanoate is sourced from PubChem (CID 118348646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).