C20H42O2S — CID 146492353
3-[dimethyl(propan-2-yl)-λ4-sulfanyl]propyl 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 146492353) has the molecular formula C20H42O2S and a molecular weight of 346.62 g/mol. Its IUPAC name is 3-[dimethyl(propan-2-yl)-λ4-sulfanyl]propyl 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | 3-[dimethyl(propan-2-yl)-λ4-sulfanyl]propyl 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 146492353 |
| Molecular Formula | C20H42O2S |
| Molecular Weight | 346.62 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | 3-[dimethyl(propan-2-yl)-λ4-sulfanyl]propyl 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CC(C)S(C)(C)CCCOC(=O)C(C)(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C20H42O2S/c1-16(2)23(10,11)14-12-13-22-17(21)20(9,19(6,7)8)15-18(3,4)5/h16H,12-15H2,1-11H3 |
| InChIKey | ZDGYUIWATJQLFU-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.62 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|