C23H41F3O4 — CID 123936375
2-[1-[4-(trifluoromethyl)cyclohexyl]oxyethoxy]ethyl 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 123936375) has the molecular formula C23H41F3O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is 2-[1-[4-(trifluoromethyl)cyclohexyl]oxyethoxy]ethyl 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | 2-[1-[4-(trifluoromethyl)cyclohexyl]oxyethoxy]ethyl 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 123936375 |
| Molecular Formula | C23H41F3O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | 2-[1-[4-(trifluoromethyl)cyclohexyl]oxyethoxy]ethyl 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CC(OCCOC(=O)C(C)(CC(C)(C)C)C(C)(C)C)OC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C23H41F3O4/c1-16(30-18-11-9-17(10-12-18)23(24,25)26)28-13-14-29-19(27)22(8,21(5,6)7)15-20(2,3)4/h16-18H,9-15H2,1-8H3 |
| InChIKey | XNJBGMUXVKLPFF-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|