C21H40O3 — CID 123586201
1-cyclohexyloxypropyl 2-tert-butyl-2,4,4-trimethylpentanoate (PubChem CID 123586201) has the molecular formula C21H40O3 and a molecular weight of 340.55 g/mol. Its IUPAC name is 1-cyclohexyloxypropyl 2-tert-butyl-2,4,4-trimethylpentanoate.
| Compound Name | 1-cyclohexyloxypropyl 2-tert-butyl-2,4,4-trimethylpentanoate |
|---|---|
| PubChem CID | 123586201 |
| Molecular Formula | C21H40O3 |
| Molecular Weight | 340.55 g/mol |
| Exact Mass | 340.30 |
| IUPAC Name | 1-cyclohexyloxypropyl 2-tert-butyl-2,4,4-trimethylpentanoate |
| SMILES | CCC(OC(=O)C(C)(CC(C)(C)C)C(C)(C)C)OC1CCCCC1 |
| InChI | InChI=1S/C21H40O3/c1-9-17(23-16-13-11-10-12-14-16)24-18(22)21(8,20(5,6)7)15-19(2,3)4/h16-17H,9-15H2,1-8H3 |
| InChIKey | OPPYCWVQBOQKMR-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.55 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|