C20H38O3 — CID 134286060
(1-cyclohexyloxy-2,2-dimethylpropyl) 2-ethyl-2,4-dimethylpentanoate (PubChem CID 134286060) has the molecular formula C20H38O3 and a molecular weight of 326.52 g/mol. Its IUPAC name is (1-cyclohexyloxy-2,2-dimethylpropyl) 2-ethyl-2,4-dimethylpentanoate.
| Compound Name | (1-cyclohexyloxy-2,2-dimethylpropyl) 2-ethyl-2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 134286060 |
| Molecular Formula | C20H38O3 |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.28 |
| IUPAC Name | (1-cyclohexyloxy-2,2-dimethylpropyl) 2-ethyl-2,4-dimethylpentanoate |
| SMILES | CCC(C)(CC(C)C)C(=O)OC(OC1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C20H38O3/c1-8-20(7,14-15(2)3)17(21)23-18(19(4,5)6)22-16-12-10-9-11-13-16/h15-16,18H,8-14H2,1-7H3 |
| InChIKey | JFEVWCZNADXVQU-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|