C23H36O3 — CID 118067347
(1-cyclohexyloxy-2,2-dimethylpropyl) 4-(2-methylbutan-2-yl)benzoate (PubChem CID 118067347) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is (1-cyclohexyloxy-2,2-dimethylpropyl) 4-(2-methylbutan-2-yl)benzoate.
| Compound Name | (1-cyclohexyloxy-2,2-dimethylpropyl) 4-(2-methylbutan-2-yl)benzoate |
|---|---|
| PubChem CID | 118067347 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | (1-cyclohexyloxy-2,2-dimethylpropyl) 4-(2-methylbutan-2-yl)benzoate |
| SMILES | CCC(C)(C)c1ccc(C(=O)OC(OC2CCCCC2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H36O3/c1-7-23(5,6)18-15-13-17(14-16-18)20(24)26-21(22(2,3)4)25-19-11-9-8-10-12-19/h13-16,19,21H,7-12H2,1-6H3 |
| InChIKey | XZUMJMSCFMVETD-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|