About cyclohexyl 2,3,3-trimethyl-2-(2-methylpropyl)pentanoate
cyclohexyl 2,3,3-trimethyl-2-(2-methylpropyl)pentanoate (PubChem CID 71201522) has the molecular formula C18H34O2
and a molecular weight of 282.47 g/mol. Its IUPAC name is cyclohexyl 2,3,3-trimethyl-2-(2-methylpropyl)pentanoate.
Analyze cyclohexyl 2,3,3-trimethyl-2-(2-methylpropyl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl 2,3,3-trimethyl-2-(2-methylpropyl)pentanoate?
The IUPAC name of cyclohexyl 2,3,3-trimethyl-2-(2-methylpropyl)pentanoate (CID 71201522) is cyclohexyl 2,3,3-trimethyl-2-(2-methylpropyl)pentanoate.
What is the SMILES notation for cyclohexyl 2,3,3-trimethyl-2-(2-methylpropyl)pentanoate?
The canonical SMILES for cyclohexyl 2,3,3-trimethyl-2-(2-methylpropyl)pentanoate is CCC(C)(C)C(C)(CC(C)C)C(=O)OC1CCCCC1.
What is the InChIKey of cyclohexyl 2,3,3-trimethyl-2-(2-methylpropyl)pentanoate?
The InChIKey is YGUDWPSUFYLZOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H34O2/c1-7-17(4,5)18(6,13-14(2)3)16(19)20-15-11-9-8-10-12-15/h14-15H,7-13H2,1-6H3.
What are the key properties of cyclohexyl 2,3,3-trimethyl-2-(2-methylpropyl)pentanoate?
cyclohexyl 2,3,3-trimethyl-2-(2-methylpropyl)pentanoate has a molecular weight of 282.47 g/mol, XLogP of 5.35, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 2,3,3-trimethyl-2-(2-methylpropyl)pentanoate is sourced from PubChem (CID 71201522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).