C19H36O3 — CID 134286032
2-cyclohexyloxypropan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate (PubChem CID 134286032) has the molecular formula C19H36O3 and a molecular weight of 312.49 g/mol. Its IUPAC name is 2-cyclohexyloxypropan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate.
| Compound Name | 2-cyclohexyloxypropan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 134286032 |
| Molecular Formula | C19H36O3 |
| Molecular Weight | 312.49 g/mol |
| Exact Mass | 312.27 |
| IUPAC Name | 2-cyclohexyloxypropan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate |
| SMILES | CC(C)CC(C)(C(=O)OC(C)(C)OC1CCCCC1)C(C)C |
| InChI | InChI=1S/C19H36O3/c1-14(2)13-19(7,15(3)4)17(20)22-18(5,6)21-16-11-9-8-10-12-16/h14-16H,8-13H2,1-7H3 |
| InChIKey | PWHNEXIMIHWXRH-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.49 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|