About 2,3-dimethylbutan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate
2,3-dimethylbutan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate (PubChem CID 90329075) has the molecular formula C16H32O2
and a molecular weight of 256.43 g/mol. Its IUPAC name is 2,3-dimethylbutan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate.
Analyze 2,3-dimethylbutan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbutan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate?
The IUPAC name of 2,3-dimethylbutan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate (CID 90329075) is 2,3-dimethylbutan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate.
What is the SMILES notation for 2,3-dimethylbutan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate?
The canonical SMILES for 2,3-dimethylbutan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate is CC(C)CC(C)(C(=O)OC(C)(C)C(C)C)C(C)C.
What is the InChIKey of 2,3-dimethylbutan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate?
The InChIKey is ZRBVCDINXXCQBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O2/c1-11(2)10-16(9,13(5)6)14(17)18-15(7,8)12(3)4/h11-13H,10H2,1-9H3.
What are the key properties of 2,3-dimethylbutan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate?
2,3-dimethylbutan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate has a molecular weight of 256.43 g/mol, XLogP of 4.67, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbutan-2-yl 2,4-dimethyl-2-propan-2-ylpentanoate is sourced from PubChem (CID 90329075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).