C10H21NO — CID 89006805
(2S)-2,4-dimethyl-2-propan-2-ylpentanamide (PubChem CID 89006805) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is (2S)-2,4-dimethyl-2-propan-2-ylpentanamide.
| Compound Name | (2S)-2,4-dimethyl-2-propan-2-ylpentanamide |
|---|---|
| PubChem CID | 89006805 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | (2S)-2,4-dimethyl-2-propan-2-ylpentanamide |
| SMILES | CC(C)C[C@](C)(C(N)=O)C(C)C |
| InChI | InChI=1S/C10H21NO/c1-7(2)6-10(5,8(3)4)9(11)12/h7-8H,6H2,1-5H3,(H2,11,12)/t10-/m0/s1 |
| InChIKey | PUBFMALZNACDOY-JTQLQIEISA-N |
| XLogP | 2.18 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |