C14H29NO — CID 170848547
4-methyl-2,2-bis(2-methylpropyl)pentanamide (PubChem CID 170848547) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is 4-methyl-2,2-bis(2-methylpropyl)pentanamide.
| Compound Name | 4-methyl-2,2-bis(2-methylpropyl)pentanamide |
|---|---|
| PubChem CID | 170848547 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 4-methyl-2,2-bis(2-methylpropyl)pentanamide |
| SMILES | CC(C)CC(CC(C)C)(CC(C)C)C(N)=O |
| InChI | InChI=1S/C14H29NO/c1-10(2)7-14(13(15)16,8-11(3)4)9-12(5)6/h10-12H,7-9H2,1-6H3,(H2,15,16) |
| InChIKey | AWEJGBVNOGKGTF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |