C16H30O4 — CID 89052204
5-methyl-3-(2-methylpropoxycarbonyl)-3-(2-methylpropyl)hexanoic acid (PubChem CID 89052204) has the molecular formula C16H30O4 and a molecular weight of 286.41 g/mol. Its IUPAC name is 5-methyl-3-(2-methylpropoxycarbonyl)-3-(2-methylpropyl)hexanoic acid.
| Compound Name | 5-methyl-3-(2-methylpropoxycarbonyl)-3-(2-methylpropyl)hexanoic acid |
|---|---|
| PubChem CID | 89052204 |
| Molecular Formula | C16H30O4 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.21 |
| IUPAC Name | 5-methyl-3-(2-methylpropoxycarbonyl)-3-(2-methylpropyl)hexanoic acid |
| SMILES | CC(C)COC(=O)C(CC(=O)O)(CC(C)C)CC(C)C |
| InChI | InChI=1S/C16H30O4/c1-11(2)7-16(8-12(3)4,9-14(17)18)15(19)20-10-13(5)6/h11-13H,7-10H2,1-6H3,(H,17,18) |
| InChIKey | JHWPDMNHROKZKN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |