bis(2-methylpropyl) 2,2-bis(3-methylbutyl)butanedioate

C22H42O4 — CID 175175541

IUPACbis(2-methylpropyl) 2,2-bis(3-methylbutyl)butanedioate
SMILESCC(C)CCC(CCC(C)C)(CC(=O)OCC(C)C)C(=O)OCC(C)C
InChIInChI=1S/C22H42O4/c1-16(2)9-11-22(12-10-17(3)4,21(24)26-15-19(7)8)13-20(23)25-14-18(5)6/h16-19H,9-15H2,1-8H3
InChIKeyGVPKXITUNZHCQT-UHFFFAOYSA-N
MW370.57 g/mol
LogP5.63
Rot. Bonds13

About bis(2-methylpropyl) 2,2-bis(3-methylbutyl)butanedioate

bis(2-methylpropyl) 2,2-bis(3-methylbutyl)butanedioate (PubChem CID 175175541) has the molecular formula C22H42O4 and a molecular weight of 370.57 g/mol. Its IUPAC name is bis(2-methylpropyl) 2,2-bis(3-methylbutyl)butanedioate.

Molecular Properties

Compound Namebis(2-methylpropyl) 2,2-bis(3-methylbutyl)butanedioate
PubChem CID175175541
Molecular FormulaC22H42O4
Molecular Weight370.57 g/mol
Exact Mass370.31
IUPAC Namebis(2-methylpropyl) 2,2-bis(3-methylbutyl)butanedioate
SMILESCC(C)CCC(CCC(C)C)(CC(=O)OCC(C)C)C(=O)OCC(C)C
InChIInChI=1S/C22H42O4/c1-16(2)9-11-22(12-10-17(3)4,21(24)26-15-19(7)8)13-20(23)25-14-18(5)6/h16-19H,9-15H2,1-8H3
InChIKeyGVPKXITUNZHCQT-UHFFFAOYSA-N
XLogP5.63
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds13
Heavy Atoms26
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500370.57
LogP ≤ 55.63
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze bis(2-methylpropyl) 2,2-bis(3-methylbutyl)butanedioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of bis(2-methylpropyl) 2,2-bis(3-methylbutyl)butanedioate?
The IUPAC name of bis(2-methylpropyl) 2,2-bis(3-methylbutyl)butanedioate (CID 175175541) is bis(2-methylpropyl) 2,2-bis(3-methylbutyl)butanedioate.
What is the SMILES notation for bis(2-methylpropyl) 2,2-bis(3-methylbutyl)butanedioate?
The canonical SMILES for bis(2-methylpropyl) 2,2-bis(3-methylbutyl)butanedioate is CC(C)CCC(CCC(C)C)(CC(=O)OCC(C)C)C(=O)OCC(C)C.
What is the InChIKey of bis(2-methylpropyl) 2,2-bis(3-methylbutyl)butanedioate?
The InChIKey is GVPKXITUNZHCQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42O4/c1-16(2)9-11-22(12-10-17(3)4,21(24)26-15-19(7)8)13-20(23)25-14-18(5)6/h16-19H,9-15H2,1-8H3.
What are the key properties of bis(2-methylpropyl) 2,2-bis(3-methylbutyl)butanedioate?
bis(2-methylpropyl) 2,2-bis(3-methylbutyl)butanedioate has a molecular weight of 370.57 g/mol, XLogP of 5.63, 13 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylpropyl) 2,2-bis(3-methylbutyl)butanedioate is sourced from PubChem (CID 175175541), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).