C22H42O4 — CID 175175541
bis(2-methylpropyl) 2,2-bis(3-methylbutyl)butanedioate (PubChem CID 175175541) has the molecular formula C22H42O4 and a molecular weight of 370.57 g/mol. Its IUPAC name is bis(2-methylpropyl) 2,2-bis(3-methylbutyl)butanedioate.
| Compound Name | bis(2-methylpropyl) 2,2-bis(3-methylbutyl)butanedioate |
|---|---|
| PubChem CID | 175175541 |
| Molecular Formula | C22H42O4 |
| Molecular Weight | 370.57 g/mol |
| Exact Mass | 370.31 |
| IUPAC Name | bis(2-methylpropyl) 2,2-bis(3-methylbutyl)butanedioate |
| SMILES | CC(C)CCC(CCC(C)C)(CC(=O)OCC(C)C)C(=O)OCC(C)C |
| InChI | InChI=1S/C22H42O4/c1-16(2)9-11-22(12-10-17(3)4,21(24)26-15-19(7)8)13-20(23)25-14-18(5)6/h16-19H,9-15H2,1-8H3 |
| InChIKey | GVPKXITUNZHCQT-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.57 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |