C12H25O5P — CID 123158747
2-dihydroxyphosphanyloxyethyl 2,4-dimethyl-2-propan-2-ylpentanoate (PubChem CID 123158747) has the molecular formula C12H25O5P and a molecular weight of 280.30 g/mol. Its IUPAC name is 2-dihydroxyphosphanyloxyethyl 2,4-dimethyl-2-propan-2-ylpentanoate.
| Compound Name | 2-dihydroxyphosphanyloxyethyl 2,4-dimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 123158747 |
| Molecular Formula | C12H25O5P |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 2-dihydroxyphosphanyloxyethyl 2,4-dimethyl-2-propan-2-ylpentanoate |
| SMILES | CC(C)CC(C)(C(=O)OCCOP(O)O)C(C)C |
| InChI | InChI=1S/C12H25O5P/c1-9(2)8-12(5,10(3)4)11(13)16-6-7-17-18(14)15/h9-10,14-15H,6-8H2,1-5H3 |
| InChIKey | QRYNYEPSRPTPOC-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|