C17H36NO6P — CID 140898597
2-(2,4-dimethyl-2-propan-2-ylpentanoyl)oxyethyl 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 140898597) has the molecular formula C17H36NO6P and a molecular weight of 381.45 g/mol. Its IUPAC name is 2-(2,4-dimethyl-2-propan-2-ylpentanoyl)oxyethyl 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | 2-(2,4-dimethyl-2-propan-2-ylpentanoyl)oxyethyl 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 140898597 |
| Molecular Formula | C17H36NO6P |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 2-(2,4-dimethyl-2-propan-2-ylpentanoyl)oxyethyl 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC(C)CC(C)(C(=O)OCCOP(=O)([O-])OCC[N+](C)(C)C)C(C)C |
| InChI | InChI=1S/C17H36NO6P/c1-14(2)13-17(5,15(3)4)16(19)22-11-12-24-25(20,21)23-10-9-18(6,7)8/h14-15H,9-13H2,1-8H3 |
| InChIKey | VXYGCKNHIUQSPI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|