C21H42NO8P — CID 59002362
2-(5-butoxy-2-ethyl-2,4,4-trimethyl-5-oxopentanoyl)oxyethyl 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 59002362) has the molecular formula C21H42NO8P and a molecular weight of 467.54 g/mol. Its IUPAC name is 2-(5-butoxy-2-ethyl-2,4,4-trimethyl-5-oxopentanoyl)oxyethyl 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | 2-(5-butoxy-2-ethyl-2,4,4-trimethyl-5-oxopentanoyl)oxyethyl 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 59002362 |
| Molecular Formula | C21H42NO8P |
| Molecular Weight | 467.54 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 2-(5-butoxy-2-ethyl-2,4,4-trimethyl-5-oxopentanoyl)oxyethyl 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCOC(=O)C(C)(C)CC(C)(CC)C(=O)OCCOP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C21H42NO8P/c1-9-11-13-27-18(23)20(3,4)17-21(5,10-2)19(24)28-15-16-30-31(25,26)29-14-12-22(6,7)8/h9-17H2,1-8H3 |
| InChIKey | NZFJLPCIDBASRK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 111.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.54 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|