C20H42NO7P — CID 159582564
2-(2,2-dimethylbutanoyloxy)ethyl 2-(trimethylazaniumyl)ethyl phosphate;3,3-dimethylpentan-2-one (PubChem CID 159582564) has the molecular formula C20H42NO7P and a molecular weight of 439.53 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoyloxy)ethyl 2-(trimethylazaniumyl)ethyl phosphate;3,3-dimethylpentan-2-one.
| Compound Name | 2-(2,2-dimethylbutanoyloxy)ethyl 2-(trimethylazaniumyl)ethyl phosphate;3,3-dimethylpentan-2-one |
|---|---|
| PubChem CID | 159582564 |
| Molecular Formula | C20H42NO7P |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 2-(2,2-dimethylbutanoyloxy)ethyl 2-(trimethylazaniumyl)ethyl phosphate;3,3-dimethylpentan-2-one |
| SMILES | CCC(C)(C)C(=O)OCCOP(=O)([O-])OCC[N+](C)(C)C.CCC(C)(C)C(C)=O |
| InChI | InChI=1S/C13H28NO6P.C7H14O/c1-7-13(2,3)12(15)18-10-11-20-21(16,17)19-9-8-14(4,5)6;1-5-7(3,4)6(2)8/h7-11H2,1-6H3;5H2,1-4H3 |
| InChIKey | MJEZKVYWHMUMGE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 101.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|