C13H27F3N2O6S2 — CID 158744516
2-(2,2-dimethylbutanoyloxy)ethyl-trimethylazanium;methylsulfonyl(trifluoromethylsulfonyl)azanide (PubChem CID 158744516) has the molecular formula C13H27F3N2O6S2 and a molecular weight of 428.50 g/mol. Its IUPAC name is 2-(2,2-dimethylbutanoyloxy)ethyl-trimethylazanium;methylsulfonyl(trifluoromethylsulfonyl)azanide.
| Compound Name | 2-(2,2-dimethylbutanoyloxy)ethyl-trimethylazanium;methylsulfonyl(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 158744516 |
| Molecular Formula | C13H27F3N2O6S2 |
| Molecular Weight | 428.50 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 2-(2,2-dimethylbutanoyloxy)ethyl-trimethylazanium;methylsulfonyl(trifluoromethylsulfonyl)azanide |
| SMILES | CCC(C)(C)C(=O)OCC[N+](C)(C)C.CS(=O)(=O)[N-]S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C11H24NO2.C2H3F3NO4S2/c1-7-11(2,3)10(13)14-9-8-12(4,5)6;1-11(7,8)6-12(9,10)2(3,4)5/h7-9H2,1-6H3;1H3/q+1;-1 |
| InChIKey | IMSFSGUDFMUKOJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 108.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.50 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|