About [4-[3-(2,2-dimethylbutanoyloxy)propoxy]phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide
[4-[3-(2,2-dimethylbutanoyloxy)propoxy]phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 140789669) has the molecular formula C16H21F3NO7S2-
and a molecular weight of 460.47 g/mol. Its IUPAC name is [4-[3-(2,2-dimethylbutanoyloxy)propoxy]phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide.
Molecular Properties
| Compound Name | [4-[3-(2,2-dimethylbutanoyloxy)propoxy]phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide |
| PubChem CID | 140789669 |
| Molecular Formula | C16H21F3NO7S2- |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | [4-[3-(2,2-dimethylbutanoyloxy)propoxy]phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | CCC(C)(C)C(=O)OCCCOc1ccc(S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H21F3NO7S2/c1-4-15(2,3)14(21)27-11-5-10-26-12-6-8-13(9-7-12)28(22,23)20-29(24,25)16(17,18)19/h6-9H,4-5,10-11H2,1-3H3/q-1 |
| InChIKey | QNGOCZKWTSXKCM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 117.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [4-[3-(2,2-dimethylbutanoyloxy)propoxy]phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[3-(2,2-dimethylbutanoyloxy)propoxy]phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide?
The IUPAC name of [4-[3-(2,2-dimethylbutanoyloxy)propoxy]phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide (CID 140789669) is [4-[3-(2,2-dimethylbutanoyloxy)propoxy]phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide.
What is the SMILES notation for [4-[3-(2,2-dimethylbutanoyloxy)propoxy]phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide?
The canonical SMILES for [4-[3-(2,2-dimethylbutanoyloxy)propoxy]phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide is CCC(C)(C)C(=O)OCCCOc1ccc(S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F)cc1.
What is the InChIKey of [4-[3-(2,2-dimethylbutanoyloxy)propoxy]phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide?
The InChIKey is QNGOCZKWTSXKCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21F3NO7S2/c1-4-15(2,3)14(21)27-11-5-10-26-12-6-8-13(9-7-12)28(22,23)20-29(24,25)16(17,18)19/h6-9H,4-5,10-11H2,1-3H3/q-1.
What are the key properties of [4-[3-(2,2-dimethylbutanoyloxy)propoxy]phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide?
[4-[3-(2,2-dimethylbutanoyloxy)propoxy]phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide has a molecular weight of 460.47 g/mol, XLogP of 3.35, 10 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[3-(2,2-dimethylbutanoyloxy)propoxy]phenyl]sulfonyl-(trifluoromethylsulfonyl)azanide is sourced from PubChem (CID 140789669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).