C16H21F3NO7S2- — CID 176641501
3-(2,2-dimethylbutanoyloxy)propylsulfonyl-[4-(trifluoromethoxy)phenyl]sulfonylazanide (PubChem CID 176641501) has the molecular formula C16H21F3NO7S2- and a molecular weight of 460.47 g/mol. Its IUPAC name is 3-(2,2-dimethylbutanoyloxy)propylsulfonyl-[4-(trifluoromethoxy)phenyl]sulfonylazanide.
| Compound Name | 3-(2,2-dimethylbutanoyloxy)propylsulfonyl-[4-(trifluoromethoxy)phenyl]sulfonylazanide |
|---|---|
| PubChem CID | 176641501 |
| Molecular Formula | C16H21F3NO7S2- |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | 3-(2,2-dimethylbutanoyloxy)propylsulfonyl-[4-(trifluoromethoxy)phenyl]sulfonylazanide |
| SMILES | CCC(C)(C)C(=O)OCCCS(=O)(=O)[N-]S(=O)(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H21F3NO7S2/c1-4-15(2,3)14(21)26-10-5-11-28(22,23)20-29(24,25)13-8-6-12(7-9-13)27-16(17,18)19/h6-9H,4-5,10-11H2,1-3H3/q-1 |
| InChIKey | MMUYEAWKIMGEER-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 117.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|