C18H40NO10P — CID 58922621
2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 58922621) has the molecular formula C18H40NO10P and a molecular weight of 461.49 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | 2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 58922621 |
| Molecular Formula | C18H40NO10P |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | 2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | COCCOCCOCCOCCOCCOCCOP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C18H40NO10P/c1-19(2,3)5-6-28-30(20,21)29-18-17-27-16-15-26-14-13-25-12-11-24-10-9-23-8-7-22-4/h5-18H2,1-4H3 |
| InChIKey | XUXLKGCEYCVDOR-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 113.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|