C20H25O4P — CID 164525001
2-diphenylphosphoryloxyethyl 2,2-dimethylbutanoate (PubChem CID 164525001) has the molecular formula C20H25O4P and a molecular weight of 360.39 g/mol. Its IUPAC name is 2-diphenylphosphoryloxyethyl 2,2-dimethylbutanoate.
| Compound Name | 2-diphenylphosphoryloxyethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 164525001 |
| Molecular Formula | C20H25O4P |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 2-diphenylphosphoryloxyethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCOP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25O4P/c1-4-20(2,3)19(21)23-15-16-24-25(22,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14H,4,15-16H2,1-3H3 |
| InChIKey | JYACZQBRCFXKEJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|