C25H35O8P — CID 123606407
(2-phenylphenyl) 2-methylbutanoate;2-phosphonooxyethyl 2,2-dimethylbutanoate (PubChem CID 123606407) has the molecular formula C25H35O8P and a molecular weight of 494.52 g/mol. Its IUPAC name is (2-phenylphenyl) 2-methylbutanoate;2-phosphonooxyethyl 2,2-dimethylbutanoate.
| Compound Name | (2-phenylphenyl) 2-methylbutanoate;2-phosphonooxyethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 123606407 |
| Molecular Formula | C25H35O8P |
| Molecular Weight | 494.52 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | (2-phenylphenyl) 2-methylbutanoate;2-phosphonooxyethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCOP(=O)(O)O.CCC(C)C(=O)Oc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C17H18O2.C8H17O6P/c1-3-13(2)17(18)19-16-12-8-7-11-15(16)14-9-5-4-6-10-14;1-4-8(2,3)7(9)13-5-6-14-15(10,11)12/h4-13H,3H2,1-2H3;4-6H2,1-3H3,(H2,10,11,12) |
| InChIKey | SQXYORVRHITSPA-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.52 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|