C34H38NO10P — CID 90697545
N-(9,10-dioxoanthracen-2-yl)-4-(2-methylbutanoyl)benzamide;2-phosphonooxyethyl 2,2-dimethylbutanoate (PubChem CID 90697545) has the molecular formula C34H38NO10P and a molecular weight of 651.65 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-2-yl)-4-(2-methylbutanoyl)benzamide;2-phosphonooxyethyl 2,2-dimethylbutanoate.
| Compound Name | N-(9,10-dioxoanthracen-2-yl)-4-(2-methylbutanoyl)benzamide;2-phosphonooxyethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 90697545 |
| Molecular Formula | C34H38NO10P |
| Molecular Weight | 651.65 g/mol |
| Exact Mass | 651.22 |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)-4-(2-methylbutanoyl)benzamide;2-phosphonooxyethyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OCCOP(=O)(O)O.CCC(C)C(=O)c1ccc(C(=O)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C26H21NO4.C8H17O6P/c1-3-15(2)23(28)16-8-10-17(11-9-16)26(31)27-18-12-13-21-22(14-18)25(30)20-7-5-4-6-19(20)24(21)29;1-4-8(2,3)7(9)13-5-6-14-15(10,11)12/h4-15H,3H2,1-2H3,(H,27,31);4-6H2,1-3H3,(H2,10,11,12) |
| InChIKey | ASTQYVXIHRSZRO-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 173.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.65 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|