C25H20N2O5 — CID 55781819
methyl 2-[[2-[4-[(9-oxofluorene-2-carbonyl)amino]phenyl]acetyl]amino]acetate (PubChem CID 55781819) has the molecular formula C25H20N2O5 and a molecular weight of 428.44 g/mol. Its IUPAC name is methyl 2-[[2-[4-[(9-oxofluorene-2-carbonyl)amino]phenyl]acetyl]amino]acetate.
| Compound Name | methyl 2-[[2-[4-[(9-oxofluorene-2-carbonyl)amino]phenyl]acetyl]amino]acetate |
|---|---|
| PubChem CID | 55781819 |
| Molecular Formula | C25H20N2O5 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | methyl 2-[[2-[4-[(9-oxofluorene-2-carbonyl)amino]phenyl]acetyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)Cc1ccc(NC(=O)c2ccc3c(c2)C(=O)c2ccccc2-3)cc1 |
| InChI | InChI=1S/C25H20N2O5/c1-32-23(29)14-26-22(28)12-15-6-9-17(10-7-15)27-25(31)16-8-11-19-18-4-2-3-5-20(18)24(30)21(19)13-16/h2-11,13H,12,14H2,1H3,(H,26,28)(H,27,31) |
| InChIKey | ZYCBXHFNCOHSTM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |