C22H13NO5 — CID 155606415
4-[(9,10-dioxoanthracene-2-carbonyl)amino]benzoic acid (PubChem CID 155606415) has the molecular formula C22H13NO5 and a molecular weight of 371.35 g/mol. Its IUPAC name is 4-[(9,10-dioxoanthracene-2-carbonyl)amino]benzoic acid.
| Compound Name | 4-[(9,10-dioxoanthracene-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 155606415 |
| Molecular Formula | C22H13NO5 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 4-[(9,10-dioxoanthracene-2-carbonyl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(NC(=O)c2ccc3c(c2)C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C22H13NO5/c24-19-15-3-1-2-4-16(15)20(25)18-11-13(7-10-17(18)19)21(26)23-14-8-5-12(6-9-14)22(27)28/h1-11H,(H,23,26)(H,27,28) |
| InChIKey | BLFMQUGTHNRCHS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|