C30H20N6O5 — CID 146542595
N-[4-[[4-hydroxy-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]phenyl]-9,10-dioxoanthracene-2-carboxamide (PubChem CID 146542595) has the molecular formula C30H20N6O5 and a molecular weight of 544.53 g/mol. Its IUPAC name is N-[4-[[4-hydroxy-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]phenyl]-9,10-dioxoanthracene-2-carboxamide.
| Compound Name | N-[4-[[4-hydroxy-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]phenyl]-9,10-dioxoanthracene-2-carboxamide |
|---|---|
| PubChem CID | 146542595 |
| Molecular Formula | C30H20N6O5 |
| Molecular Weight | 544.53 g/mol |
| Exact Mass | 544.15 |
| IUPAC Name | N-[4-[[4-hydroxy-6-(4-hydroxyanilino)-1,3,5-triazin-2-yl]amino]phenyl]-9,10-dioxoanthracene-2-carboxamide |
| SMILES | O=C(Nc1ccc(Nc2nc(O)nc(Nc3ccc(O)cc3)n2)cc1)c1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C30H20N6O5/c37-20-12-10-19(11-13-20)33-29-34-28(35-30(41)36-29)32-18-8-6-17(7-9-18)31-27(40)16-5-14-23-24(15-16)26(39)22-4-2-1-3-21(22)25(23)38/h1-15,37H,(H,31,40)(H3,32,33,34,35,36,41) |
| InChIKey | UJAYNZCLUXFMHN-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 166.43 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|